akos bb-2983 structure
|
Common Name | akos bb-2983 | ||
|---|---|---|---|---|
| CAS Number | 662154-28-1 | Molecular Weight | 273.28400 | |
| Density | 1.21g/cm3 | Boiling Point | 479.3ºC at 760 mmHg | |
| Molecular Formula | C15H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.7ºC | |
| Name | akos bb-2983 |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 479.3ºC at 760 mmHg |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.28400 |
| Flash Point | 243.7ºC |
| Exact Mass | 273.10000 |
| PSA | 68.53000 |
| LogP | 2.37000 |
| Index of Refraction | 1.574 |
| InChIKey | ZUJFOJPVRRGGKE-UHFFFAOYSA-N |
| SMILES | Cc1cc(C=O)c(C)n1-c1ccc(OCC(=O)O)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |