Benzoic acid,5-(acetylamino)-4-methyl-2-nitro-
Modify Date: 2024-01-08 17:14:36
Benzoic acid,5-(acetylamino)-4-methyl-2-nitro- structure
|
Common Name | Benzoic acid,5-(acetylamino)-4-methyl-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 6632-23-1 | Molecular Weight | 238.19700 | |
| Density | 1.459g/cm3 | Boiling Point | 508.3ºC at 760 mmHg | |
| Molecular Formula | C10H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.2ºC | |
| Name | 5-acetamido-4-methyl-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.459g/cm3 |
|---|---|
| Boiling Point | 508.3ºC at 760 mmHg |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.19700 |
| Flash Point | 261.2ºC |
| Exact Mass | 238.05900 |
| PSA | 112.22000 |
| LogP | 2.15600 |
| Index of Refraction | 1.64 |
| InChIKey | IGZVJBLUWSNLCT-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(C(=O)O)c([N+](=O)[O-])cc1C |
| HS Code | 2924299090 |
|---|
|
~0%
Benzoic acid,5-... CAS#:6632-23-1 |
| Literature: Clews, John; Curtis, Anthony D.M.; Malkin, Hugh Tetrahedron, 2000 , vol. 56, # 44 p. 8735 - 8746 |
|
~%
Benzoic acid,5-... CAS#:6632-23-1 |
| Literature: Clews, John; Curtis, Anthony D.M.; Malkin, Hugh Tetrahedron, 2000 , vol. 56, # 44 p. 8735 - 8746 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Acetamino-2-nitro-p-toluolsaeure |