4',5-Dihydroxyflavone structure
|
Common Name | 4',5-Dihydroxyflavone | ||
|---|---|---|---|---|
| CAS Number | 6665-67-4 | Molecular Weight | 254.238 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 486.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H10O4 | Melting Point | 239-240ºC | |
| MSDS | N/A | Flash Point | 190.0±22.2 °C | |
Use of 4',5-Dihydroxyflavone4',5-Dihydroxyflavone is a soybean LOX-1 and yeast α-Glucosidase inhibitor, with an Ki of 102.6 μM for soybean LOX-1 and an IC50 of 66 μM for yeast α-glucosidase. |
| Name | 5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 4',5-Dihydroxyflavone is a soybean LOX-1 and yeast α-Glucosidase inhibitor, with an Ki of 102.6 μM for soybean LOX-1 and an IC50 of 66 μM for yeast α-glucosidase. |
|---|---|
| Related Catalog | |
| Target |
Ki: 102.6 μM (LOX-1)[1]. IC50: 66 μM (α-glucosidase)[2]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 486.0±45.0 °C at 760 mmHg |
| Melting Point | 239-240ºC |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.238 |
| Flash Point | 190.0±22.2 °C |
| Exact Mass | 254.057907 |
| PSA | 70.67000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | OKRNDQLCMXUCGG-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cccc(O)c12 |
| Storage condition | 2-8℃ |
| HS Code | 2914501900 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4H-1-Benzopyran-4-one, 5-hydroxy-2-(4-hydroxyphenyl)- |
| 4',5-Dihydroxyflavone |
| 5-Hydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| 4',5-dihydroxy flavone |
| 5,4'-Dihydroxyflavone |