n-desethyl-pirimiphos-methyl structure
|
Common Name | n-desethyl-pirimiphos-methyl | ||
|---|---|---|---|---|
| CAS Number | 67018-59-1 | Molecular Weight | 249.22700 | |
| Density | 1.454g/cm3 | Boiling Point | 437.7ºC at 760 mmHg | |
| Molecular Formula | C7H12N3O3PS | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 218.5ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 4-dimethoxyphosphinothioyloxy-N-ethyl-6-methylpyrimidin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.454g/cm3 |
|---|---|
| Boiling Point | 437.7ºC at 760 mmHg |
| Molecular Formula | C7H12N3O3PS |
| Molecular Weight | 249.22700 |
| Flash Point | 218.5ºC |
| Exact Mass | 249.03400 |
| PSA | 132.63000 |
| LogP | 0.87720 |
| Index of Refraction | 1.615 |
| InChIKey | FMJYNECHJIZSCE-UHFFFAOYSA-N |
| SMILES | CCNc1nc(C)cc(OP(=S)(OC)OC)n1 |
| Storage condition | 2-8°C |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-37/38-41 |
| Safety Phrases | 26-39 |
| RIDADR | NONH for all modes of transport |
| 4-dimethoxyphosphinothioyloxy-N-ethyl-6-methyl-pyrimidin-2-amine |
| Phosphorothioic acid,O-(2-(ethylamino)-6-methyl-4-pyrimidinyl) O,O-dimethyl ester |