2-[3,5-bis-(Trifluoromethyl)phenyl]propan-2-ol structure
|
Common Name | 2-[3,5-bis-(Trifluoromethyl)phenyl]propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 67570-38-1 | Molecular Weight | 272.18700 | |
| Density | 1.333g/cm3 | Boiling Point | 184.2ºC at 760 mmHg | |
| Molecular Formula | C11H10F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 65.2ºC | |
| Name | 2-[3,5-Bis(trifluoromethyl)phenyl]propan-2-ol |
|---|
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 184.2ºC at 760 mmHg |
| Molecular Formula | C11H10F6O |
| Molecular Weight | 272.18700 |
| Flash Point | 65.2ºC |
| Exact Mass | 272.06400 |
| PSA | 20.23000 |
| LogP | 3.95160 |
| Index of Refraction | 1.418 |
| InChIKey | CLPUBDXEFYRXMU-UHFFFAOYSA-N |
| SMILES | CC(C)(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|
~%
2-[3,5-bis-(Tri... CAS#:67570-38-1 |
| Literature: EP1693367 A1, ; Page/Page column 28 ; |
|
~%
2-[3,5-bis-(Tri... CAS#:67570-38-1 |
| Literature: US2002/156313 A1, ; |
|
~94%
2-[3,5-bis-(Tri... CAS#:67570-38-1 |
| Literature: Kinoshita, Tomomi; Takemoto, Masaki; Shibayama, Koichi; Takeuchi, Ken'ichi Journal of Chemical Research, Miniprint, 1993 , # 8 p. 2153 - 2174 |
|
~%
2-[3,5-bis-(Tri... CAS#:67570-38-1 |
| Literature: Tetrahedron, , vol. 36, p. 1557 - 1564 |
|
~%
2-[3,5-bis-(Tri... CAS#:67570-38-1 |
| Literature: Australian Journal of Chemistry, , vol. 31, p. 1209 - 1221 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |