N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine structure
|
Common Name | N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine | ||
|---|---|---|---|---|
| CAS Number | 67747-01-7 | Molecular Weight | 282.59400 | |
| Density | 1.26g/cm3 | Boiling Point | 361.1ºC at 760 mmHg | |
| Molecular Formula | C11H14Cl3NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 172.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-[2-(2,4,6-trichlorophenoxy)ethyl]propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 361.1ºC at 760 mmHg |
| Molecular Formula | C11H14Cl3NO |
| Molecular Weight | 282.59400 |
| Flash Point | 172.2ºC |
| Exact Mass | 281.01400 |
| PSA | 21.26000 |
| LogP | 4.41610 |
| Index of Refraction | 1.534 |
| InChIKey | CLFQSOIBYICELN-UHFFFAOYSA-N |
| SMILES | CCCNCCOc1c(Cl)cc(Cl)cc1Cl |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H413 |
| Precautionary Statements | P301 + P312 + P330 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD09751307 |