WS 12 structure
|
Common Name | WS 12 | ||
|---|---|---|---|---|
| CAS Number | 68489-09-8 | Molecular Weight | 289.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H27NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of WS 12WS-12 is an agonist of TRPM8 with an EC50 of 39 nM. |
| Name | (1R,2S,5R)-N-(4-methoxyphenyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | WS-12 is an agonist of TRPM8 with an EC50 of 39 nM. |
|---|---|
| Related Catalog | |
| Target |
EC50: 39 nM (TRPM8)[1] |
| References |
| Molecular Formula | C18H27NO2 |
|---|---|
| Molecular Weight | 289.41200 |
| Exact Mass | 289.20400 |
| PSA | 38.33000 |
| LogP | 4.41510 |
| InChIKey | HNSGVPAAXJJOPQ-XOKHGSTOSA-N |
| SMILES | COc1ccc(NC(=O)C2CC(C)CCC2C(C)C)cc1 |
| Storage condition | 2-8℃ |
| WS 12 |
| 7-Hydroxy-DPAT hydrobromide |
| WS-12 |