zorbax lp 100/40 c4 structure
|
Common Name | zorbax lp 100/40 c4 | ||
|---|---|---|---|---|
| CAS Number | 68584-38-3 | Molecular Weight | 221.78900 | |
| Density | N/A | Boiling Point | 214.7ºC at 760 mmHg | |
| Molecular Formula | C6H12ClNO2Si2 | Melting Point | 1600ºC | |
| MSDS | Chinese USA | Flash Point | 108.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[chloro(dimethyl)silyl]butanenitrile,dioxosilane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 214.7ºC at 760 mmHg |
|---|---|
| Melting Point | 1600ºC |
| Molecular Formula | C6H12ClNO2Si2 |
| Molecular Weight | 221.78900 |
| Flash Point | 108.3ºC |
| Exact Mass | 221.01000 |
| PSA | 57.93000 |
| LogP | 2.11568 |
| InChIKey | MPHCKNJRPAUOCD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)CCCC#N.O=[Si]=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R24/25 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Silica,reaction product with 4-(chlorodimethylsilyl)butyronitrile |
| EINECS 271-537-8 |
| Butanenitrile,4-(chlorodimethylsilyl)-,hydrolysis products with silica |