zorbax lp 100/40 c4 structure
|
Common Name | zorbax lp 100/40 c4 | ||
|---|---|---|---|---|
| CAS Number | 68584-80-5 | Molecular Weight | 266.91200 | |
| Density | N/A | Boiling Point | 227.5ºC at 760 mmHg | |
| Molecular Formula | C10H23ClO2Si2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 97.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | chloro-dimethyl-octylsilane,dioxosilane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 227.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H23ClO2Si2 |
| Molecular Weight | 266.91200 |
| Flash Point | 97.8ºC |
| Exact Mass | 266.09300 |
| PSA | 34.14000 |
| LogP | 4.17240 |
| InChIKey | MBMCIQRWRYDPRE-UHFFFAOYSA-N |
| SMILES | CCCCCCCC[Si](C)(C)Cl.O=[Si]=O |
| EINECS 271-543-0 |
| Silica,reaction product with chlorodimethyloctylsilane |
| Silane,chlorodimethyloctyl-,hydrolysis products with silica |