1-(2,2-diphenylethoxysulfonyl)-4-methyl-benzene structure
|
Common Name | 1-(2,2-diphenylethoxysulfonyl)-4-methyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 6944-27-0 | Molecular Weight | 352.44700 | |
| Density | 1.195g/cm3 | Boiling Point | 516.9ºC at 760 mmHg | |
| Molecular Formula | C21H20O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.4ºC | |
| Name | 2,2-diphenylethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 516.9ºC at 760 mmHg |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.44700 |
| Flash Point | 266.4ºC |
| Exact Mass | 352.11300 |
| PSA | 51.75000 |
| LogP | 5.61320 |
| Index of Refraction | 1.597 |
| InChIKey | FGGIVUNDCMWXPU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC(c2ccccc2)c2ccccc2)cc1 |
|
~%
1-(2,2-diphenyl... CAS#:6944-27-0 |
| Literature: Winstein; Marshall Journal of the American Chemical Society, 1952 , vol. 74, p. 1120,1126 |
|
~%
1-(2,2-diphenyl... CAS#:6944-27-0 |
| Literature: Schmidt, Matthias; Ungvari, Johannes; Gloede, Julia; Dobner, Bodo; Langner, Andreas Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 6 p. 2283 - 2297 |
|
~%
1-(2,2-diphenyl... CAS#:6944-27-0 |
| Literature: Schmidt, Matthias; Ungvari, Johannes; Gloede, Julia; Dobner, Bodo; Langner, Andreas Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 6 p. 2283 - 2297 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| p-Toluolsulfonsaeure-2,2-diphenylaethylester |
| 2,2-diphenylethyl toluene-p-sulphonate |
| 2,2-diphenylethyl-2-t tosylate |