Ethanone,1-[4-[(methylsulfonyl)oxy]phenyl]- structure
|
Common Name | Ethanone,1-[4-[(methylsulfonyl)oxy]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 69497-83-2 | Molecular Weight | 214.23800 | |
| Density | 1.29g/cm3 | Boiling Point | 377.6ºC at 760mmHg | |
| Molecular Formula | C9H10O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2ºC | |
| Name | (4-acetylphenyl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 377.6ºC at 760mmHg |
| Molecular Formula | C9H10O4S |
| Molecular Weight | 214.23800 |
| Flash Point | 182.2ºC |
| Exact Mass | 214.03000 |
| PSA | 68.82000 |
| LogP | 2.30840 |
| Index of Refraction | 1.53 |
| InChIKey | FRUBCADIVWBPBB-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OS(C)(=O)=O)cc1 |
|
~97%
Ethanone,1-[4-[... CAS#:69497-83-2 |
| Literature: Kuroda, Jun-Ichi; Inamoto, Kiyofumi; Hiroya, Kou; Doi, Takayuki European Journal of Organic Chemistry, 2009 , # 14 p. 2251 - 2261 |
|
~48%
Ethanone,1-[4-[... CAS#:69497-83-2
Detail
|
| Literature: Satyamurthy, N.; Barrio, Jorge R.; Schmidt, Derrick G.; Kammerer, Craig; Bida, Gerald T.; Phelps, Michael E. Journal of Organic Chemistry, 1990 , vol. 55, # 15 p. 4560 - 4564 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| 4-acetylphenyl mesylate |
| p-Methylsulfonyloxyacetophenone |
| 4-Acetylphenyl methanesulfonate |
| 4-methanesulfonyloxyacetophenone |
| 4-acetylphenyl methylsulfonate |