4,4'-Diacetylbiphenyl structure
|
Common Name | 4,4'-Diacetylbiphenyl | ||
|---|---|---|---|---|
| CAS Number | 787-69-9 | Molecular Weight | 238.281 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 386.5±17.0 °C at 760 mmHg | |
| Molecular Formula | C16H14O2 | Melting Point | 193-195 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 144.9±17.9 °C | |
| Symbol |
GHS09 |
Signal Word | Warning | |
| Name | 4,4'-Diacetylbiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 386.5±17.0 °C at 760 mmHg |
| Melting Point | 193-195 °C(lit.) |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.281 |
| Flash Point | 144.9±17.9 °C |
| Exact Mass | 238.099380 |
| PSA | 34.14000 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | YSTSBXDVNKYPTR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(-c2ccc(C(C)=O)cc2)cc1 |
| Symbol |
GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H400 |
| Precautionary Statements | P273 |
| Personal Protective Equipment | Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S60-S61-S36/37/39-S26 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Class | 9.0 |
| HS Code | 2914399090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
The synthesis of biphenylglyoxime and bis (phenylglyoxime) and their complexes with Cu (II), Ni (II) and Co (II) Karatas I and Uçan HI.
Synth. React. Inorg. Met.-Org. Chem. 28(3) , 383-391, (1998)
|
| Ethanone, 1,1'-[1,1'-biphenyl]-4,4'-diylbis- |
| 1,1'-biphenyl-4,4'-diyldiethanone |
| 4,4'-Diacetyl biphenyl |
| 1,1'-(4,4'-Biphenyldiyl)diethanone |
| 1-[4-(4-acetylphenyl)phenyl]ethanone |
| MFCD00017248 |
| 1-(4'-Acetyl[1,1'-biphenyl]-4-yl)ethanone |