fusidic acid structure
|
Common Name | fusidic acid | ||
|---|---|---|---|---|
| CAS Number | 6990-06-3 | Molecular Weight | 516.709 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 635.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C31H48O6 | Melting Point | 190-192ºC | |
| MSDS | Chinese USA | Flash Point | 197.7±25.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of fusidic acidFusidic acid (Fusidate) is a bacteriostatic antibiotic[1][2][3]. |
| Name | fusidic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fusidic acid (Fusidate) is a bacteriostatic antibiotic[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
Bacterial[1][2][3] |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 635.6±55.0 °C at 760 mmHg |
| Melting Point | 190-192ºC |
| Molecular Formula | C31H48O6 |
| Molecular Weight | 516.709 |
| Flash Point | 197.7±25.0 °C |
| Exact Mass | 516.345093 |
| PSA | 104.06000 |
| LogP | 6.41 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | IECPWNUMDGFDKC-MZJAQBGESA-N |
| SMILES | CC(=O)OC1CC2(C)C(CC(O)C3C4(C)CCC(O)C(C)C4CCC32C)C1=C(CCC=C(C)C)C(=O)O |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| HS Code | 2942000000 |
|---|
|
Antibiotic exposure in a low-income country: screening urine samples for presence of antibiotics and antibiotic resistance in coagulase negative staphylococcal contaminants.
PLoS ONE 9(12) , e113055, (2014) Development of antimicrobial resistance has been assigned to excess and misuse of antimicrobial agents. Staphylococci are part of the normal flora but are also potential pathogens that have become ess... |
|
|
Multiple roles for Enterococcus faecalis glycosyltransferases in biofilm-associated antibiotic resistance, cell envelope integrity, and conjugative transfer.
Antimicrob. Agents Chemother. 59 , 4094-105, (2015) The emergence of multidrug-resistant bacteria and the limited availability of new antibiotics are of increasing clinical concern. A compounding factor is the ability of microorganisms to form biofilms... |
|
|
Enterococcus faecalis 6-phosphogluconolactonase is required for both commensal and pathogenic interactions with Manduca sexta.
Infect. Immun. 83(1) , 396-404, (2014) Enterococcus faecalis is a commensal and pathogen of humans and insects. In Manduca sexta, E. faecalis is an infrequent member of the commensal gut community, but its translocation to the hemocoel res... |
| (2Z)-2-[(3α,4α,5α,8α,9β,11α,13α,14β,16β,17Z)-16-(acetyloxy)-3,11-dihydroxy-4,8,10,14-tetramethylgonan-17-ylidene]-6-methylhept-5-enoic acid |
| Fucidic acid |
| Fusidate sodium |
| EINECS 230-256-0 |
| fusidic acid |
| Fusidin |
| FUCIDIN |
| (2Z)-2-[(3R,4S,5S,8S,9S,10S,11R,13R,14S,16S)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoic acid |
| (2Z)-2-[(3α,4α,5α,8α,9β,11α,13α,14β,16β,17Z)-16-Acetoxy-3,11-dihydroxy-4,8,10,14-tetramethylgonan-17-ylidene]-6-methylhept-5-enoic acid |
| Fusidate |
| 5-Heptenoic acid, 2-[(3α,4α,5α,8α,9β,11α,13α,14β,16β,17Z)-16-(acetyloxy)-3,11-dihydroxy-4,8,10,14-tetramethylgonan-17-ylidene]-6-methyl-, (2Z)- |
| Ramycin |
| fusdic acid |
| (3α,4α,5α,8α,9β,11α,13α,14β,16β,17Z)-16-Acetoxy-3,11-dihydroxy-4,8,14-trimethyl-18-norcholesta-17,24-dien-21-oic acid |
| Fucithalmic |
| Fucidin acid |
| MFCD00865135 |
| 3,11,16-Trihydroxy-4,8,10,14-tetramethyl-17-(1'-carboxyisohept-4'-enylidene)cyclopentanoperhydrophenanthrene 16-Acetate |
| FusidicAcid |
| 29-Nordammara-17(20),24-dien-21-oic acid, 16-(acetyloxy)-3,11-dihydroxy-, (3α,4α,8α,9β,11α,13α,14β,16β,17Z)- |
| (3a,4a,8a,9b,11a,13a,14b,16b,17Z)-16-(Acetyloxy)-3,11-dihydroxy-29-nordammara-17(20),24-dien-21-oic Acid |
| Diethanolamine fusidate |
| Fusidine |