Nargenicin A1 structure
|
Common Name | Nargenicin A1 | ||
|---|---|---|---|---|
| CAS Number | 70695-02-2 | Molecular Weight | 515.60 | |
| Density | 1.31g/cm3 | Boiling Point | 718.3ºC at 760 mmHg | |
| Molecular Formula | C28H37NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388.2ºC | |
Use of Nargenicin A1Nargenicin A1 is an antibiotic agent against various Gram-positive bacteria. Nargenicin A1 shows anti-inflammatory activity. Nargenicin A1 protects HINAE cells against Tacrolimus (HY-13756)-induced DNA damage and apoptosis. Nargenicin A1 can also be used for the research of acute myeloid leukemia[1]. |
| Name | nargenicin a, |
|---|
| Description | Nargenicin A1 is an antibiotic agent against various Gram-positive bacteria. Nargenicin A1 shows anti-inflammatory activity. Nargenicin A1 protects HINAE cells against Tacrolimus (HY-13756)-induced DNA damage and apoptosis. Nargenicin A1 can also be used for the research of acute myeloid leukemia[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 718.3ºC at 760 mmHg |
| Molecular Formula | C28H37NO8 |
| Molecular Weight | 515.60 |
| Flash Point | 388.2ºC |
| Exact Mass | 515.25200 |
| PSA | 127.31000 |
| LogP | 2.40040 |
| Index of Refraction | 1.595 |
| InChIKey | YEUSSARNQQYBKH-QTCPSXGDSA-N |
| SMILES | COC1CC2C=CC3C4OC2(C(C)=CC(C)C(C(C)O)OC1=O)C3C(O)C(C)C4OC(=O)c1ccc[nH]1 |