15-hydroperoxy-5,8,11,13-eicosatetraenoic acid structure
|
Common Name | 15-hydroperoxy-5,8,11,13-eicosatetraenoic acid | ||
|---|---|---|---|---|
| CAS Number | 70981-96-3 | Molecular Weight | 336.466 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 518.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 175.6±23.6 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | 15(s)-hpete |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 518.0±50.0 °C at 760 mmHg |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.466 |
| Flash Point | 175.6±23.6 °C |
| Exact Mass | 336.230072 |
| PSA | 66.76000 |
| LogP | 6.03 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | BFWYTORDSFIVKP-VAEKSGALSA-N |
| SMILES | CCCCCC(C=CC=CCC=CCC=CCCCC(=O)O)OO |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H319 |
| Precautionary Statements | P210-P280-P305 + P351 + P338-P337 + P313-P403 + P235 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F: Flammable; |
| Risk Phrases | R11 |
| Safety Phrases | 7-16 |
| RIDADR | UN 1170 3 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
The human serum metabolome.
PLoS ONE 6(2) , e16957, (2011) Continuing improvements in analytical technology along with an increased interest in performing comprehensive, quantitative metabolic profiling, is leading to increased interest pressures within the m... |
|
|
Novel role of lipoxygenases in the inflammatory response: promotion of TNF mRNA decay by 15-hydroperoxyeicosatetraenoic acid in a monocytic cell line.
J. Immunol. 174(6) , 3169-72, (2005) The metabolism of arachidonic acid via the lipoxygenase and cyclooxygenase pathways generates metabolites that regulate the inflammatory response. Although products of lipoxygenase are classically pro... |
|
|
Nature of the cardiomyocyte injury induced by lipid hydroperoxides.
Cardiovasc. Res. 30(5) , 648-55, (1995) As a result of oxidative stress to membrane lipid matrix, the peroxidation of polyunsaturated fatty acids induced the transient formation of lipid hydroperoxides (ROOH). The aim of this study was to e... |
| 15(S)-HYDROPEROXY-(5Z,8Z,11Z,13E)-EICOSATETRAENOIC ACID |
| (E,Z,Z,Z)-15-Hydroperoxy-5,8,11,13-eicosatetraenoic acid |
| (5Z,8Z,11Z,13E,15S)-15-hydroperoxyeicosa-5,8,11,13-tetraenoic acid |
| 5,8,11,13-Eicosatetraenoic acid,15-hydroperoxy-,(S-(E,Z,Z,Z)) |
| 15-hydroperoxy-5,8,11,13-eicosatetraenoic acid |
| 15-Hydroxyeicosa-5Z,8Z,11Z,13E-tetraenoic acid |
| (S-(E,Z,Z,Z))-15-Hydroperoxy-5,8,11,13-eicosatetraenoic acid |
| 15-(S)HPETE |
| (5E,8E,11E,13E)-15-Hydroperoxy-5,8,11,13-icosatetraenoic acid |
| 5,8,11,13-Eicosatetraenoic acid, 15-hydroperoxy-, (5E,8E,11E,13E)- |
| (S)-15-hydroperoxy-5(Z),8(Z),11(Z),13(E)-eicosatetaenoic acid |
| 15(S)-HpETE Lipid Maps MS Standard |
| 5,8,11,13-Eicosatetraenoic acid, 15-hydroperoxy-, (E,Z,Z,Z)- |
| 15(S)-hydroperoxy-(5Z,8Z,11Z,13E)-*eicosatetraeno |
| 15(S)-HYDROPEROXYEICOSA-5Z,8Z,11Z,13E-TETRAENOIC ACID |
| 15(S)-HYDROPEROXY-(5Z,8Z,11Z,13E)-*EICOS ATETRAENOIC |