(R)-Mephenytoin structure
|
Common Name | (R)-Mephenytoin | ||
|---|---|---|---|---|
| CAS Number | 71140-51-7 | Molecular Weight | 218.25200 | |
| Density | 1.154g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O2 | Melting Point | 137-138ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of (R)-Mephenytoin(R)-Mephenytoin ((-)-Mephenytoin), the R-enantiomer of Mephenytoin. Mephenytoin is an Anticonvulsant agent[1][2]. |
| Name | (R)-Mephenytoin |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-Mephenytoin ((-)-Mephenytoin), the R-enantiomer of Mephenytoin. Mephenytoin is an Anticonvulsant agent[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | (R)-Mephenytoin can be N-demethylated by the cytochrome P450 (CYP) isoform CYP2C9 to form the metabolite 5-phenyl-5-ethylhydantoin (nirvanol)[1]. |
| References |
| Density | 1.154g/cm3 |
|---|---|
| Melting Point | 137-138ºC |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25200 |
| Exact Mass | 218.10600 |
| PSA | 49.41000 |
| LogP | 1.74020 |
| Index of Refraction | 1.541 |
| InChIKey | GMHKMTDVRCWUDX-GFCCVEGCSA-N |
| SMILES | CCC1(c2ccccc2)NC(=O)N(C)C1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| (r)-(-)-mephenytoin |