4'-Methyl-[1,1'-biphenyl]-2-carboxylic acid structure
|
Common Name | 4'-Methyl-[1,1'-biphenyl]-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 7148-03-0 | Molecular Weight | 212.244 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 354.5±11.0 °C at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | 146-148°C | |
| MSDS | Chinese USA | Flash Point | 165.3±13.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4'-Methylbiphenyl-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.5±11.0 °C at 760 mmHg |
| Melting Point | 146-148°C |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.244 |
| Flash Point | 165.3±13.9 °C |
| Exact Mass | 212.083725 |
| PSA | 37.30000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | ZSTUEICKYWFYIC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| Storage condition | Room temperature. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
4'-Methylbiphenyl-2-carboxylic acid. Narasegowda RS, et al.
Acta Crystallogr. Sect. E Struct. Rep. Online 61(4) , 939-940, (2005)
|
| 2-(4-mehtylphenyl)benzoic acid |
| 4'-Methyl-2-biphenylboronic Acid |
| 4'-methyl-biphenyl-2-carboxylic acid |
| o-Tolylbenzoic acid |
| 4'-Methyl-2-carboxybiphenyl |
| RARECHEM AL BO 0764 |
| o-(4-methylphenyl)benzoic acid |
| 2-(4-methylphenyl)benzoic acid |
| [1,1'-Biphenyl]-2-carboxylic acid, 4'-methyl- |
| 2-(P-TOLYL)BENZOIC ACID |
| 4'-methyl-[1,1'-biphenyl]-2-carboxylic acid |
| 4'-Methyl-2-biphenylcarboxylic acid |
| MFCD00045826 |
| 4'-Methylbiphenyl-2-carboxylic acid |
| EINECS 230-462-0 |
| 4-Methyl-2'-biphenylcarboxylic acid |