6-trans-12-epi-Leukotriene B4 structure
|
Common Name | 6-trans-12-epi-Leukotriene B4 | ||
|---|---|---|---|---|
| CAS Number | 71548-19-1 | Molecular Weight | 336.466 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 536.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.3±26.6 °C | |
Use of 6-trans-12-epi-Leukotriene B46-trans-12-epi-Leukotriene B4, an arachidonic acid metabolite, is a potent anti-inflammatory agent[1]. |
| Name | Δ6-trans-12-epi-leukotriene B4 |
|---|---|
| Synonym | More Synonyms |
| Description | 6-trans-12-epi-Leukotriene B4, an arachidonic acid metabolite, is a potent anti-inflammatory agent[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 536.4±50.0 °C at 760 mmHg |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.466 |
| Flash Point | 292.3±26.6 °C |
| Exact Mass | 336.230072 |
| PSA | 77.76000 |
| LogP | 4.06 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | VNYSSYRCGWBHLG-CTOJTRLNSA-N |
| SMILES | CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)O |
| Hazard Codes | F: Flammable;Xi: Irritant; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | 16-26-36 |
| RIDADR | UN 1170 3 |
| δ(6)-trans-12-epi-leukotriene B4 |
| 6E-12-EPI-LEUKOTRIENE B4 |
| (5S,6E,8E,10E,12S,14Z)-5,12-Dihydroxy-6,8,10,14-icosatetraenoic acid |
| MFCD00065851 |
| 6,8,10,14-Eicosatetraenoic acid, 5,12-dihydroxy-, (5S,6E,8E,10E,12S,14Z)- |
| 6-TRANS-12-EPI-LTB4 |
| 6-trans-12-epi Leukotriene B4 |
| Delta(6)-trans-12-epi-leukotriene B4 |