5-(2,5-dichlorophenoxy)pentanoic acid structure
|
Common Name | 5-(2,5-dichlorophenoxy)pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7170-70-9 | Molecular Weight | 263.11700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2,5-dichlorophenoxy)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12Cl2O3 |
|---|---|
| Molecular Weight | 263.11700 |
| Exact Mass | 262.01600 |
| PSA | 46.53000 |
| LogP | 3.62710 |
| InChIKey | HTAJWIKMYZHGGN-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCOc1cc(Cl)ccc1Cl |
|
~%
5-(2,5-dichloro... CAS#:7170-70-9 |
| Literature: Fawcett et al. Proceedings of the Royal Society of London, Series B: Biological Sciences, 1959 , vol. 150, p. 95,100 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Pentanoic acid,5-(2,5-dichlorophenoxy) |
| 5-(2,5-Dichlor-phenoxy)-valeriansaeure |
| 5-(2,5-dichloro-phenoxy)-valeric acid |