1-(4'-FLUORO-BIPHENYL-4-YL)-ETHANONE structure
|
Common Name | 1-(4'-FLUORO-BIPHENYL-4-YL)-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 720-74-1 | Molecular Weight | 214.23500 | |
| Density | 1.124g/cm3 | Boiling Point | 324ºC at 760 mmHg | |
| Molecular Formula | C14H11FO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.7ºC | |
| Name | 1-[4-(4-fluorophenyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 324ºC at 760 mmHg |
| Molecular Formula | C14H11FO |
| Molecular Weight | 214.23500 |
| Flash Point | 133.7ºC |
| Exact Mass | 214.07900 |
| PSA | 17.07000 |
| LogP | 3.69530 |
| Index of Refraction | 1.552 |
| InChIKey | LGJJGWHKUXUJNR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(-c2ccc(F)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-acetyl-4'-fluorobiphenyl |
| p-MeCO-C6H4-C6H4-p-F |
| 4-p-fluorophenylacetophenone |