Biotin-PEG4-acid structure
|
Common Name | Biotin-PEG4-acid | ||
|---|---|---|---|---|
| CAS Number | 721431-18-1 | Molecular Weight | 491.59900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H37N3O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG4-acidBiotin-PEG4-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTAC. |
| Name | 3-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Biotin-PEG4-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTAC. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| Molecular Formula | C21H37N3O8S |
|---|---|
| Molecular Weight | 491.59900 |
| Exact Mass | 491.23000 |
| PSA | 169.75000 |
| LogP | 1.41800 |
| InChIKey | GYOXFFWLRKVJJX-ZWOKBUDYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| Storage condition | 2-8°C |
| Biotin-PEG4-Acid |