Biotin-PEG4-MeTz structure
|
Common Name | Biotin-PEG4-MeTz | ||
|---|---|---|---|---|
| CAS Number | 1962919-31-8 | Molecular Weight | 674.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H46N8O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG4-MeTzBiotin-PEG4-MeTz is a click chemistry reagent containing a terminal methyltetrazine group that reacts with trans-cyclooctene. Biotin-PEG4-MeTz can be used for the preparation of biotinylated conjugates[1]. |
| Name | Biotin-PEG4-MeTz |
|---|
| Description | Biotin-PEG4-MeTz is a click chemistry reagent containing a terminal methyltetrazine group that reacts with trans-cyclooctene. Biotin-PEG4-MeTz can be used for the preparation of biotinylated conjugates[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C31H46N8O7S |
|---|---|
| Molecular Weight | 674.81 |
| InChIKey | FVPKDWZJCYTWCS-ZEZDXWPOSA-N |
| SMILES | Cc1nnc(-c2ccc(CNC(=O)CCOCCOCCOCCOCCNC(=O)CCCCC3SCC4NC(=O)NC43)cc2)nn1 |