H-Val-βNA
Modify Date: 2025-09-16 09:00:42
H-Val-βNA structure
|
Common Name | H-Val-βNA | ||
|---|---|---|---|---|
| CAS Number | 729-24-8 | Molecular Weight | 242.316 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 457.9±28.0 °C at 760 mmHg | |
| Molecular Formula | C15H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.7±24.0 °C | |
Use of H-Val-βNAH-Val-βNA (L-Valine β-naphthylamide) can be used as an aminopeptidase and a Valine arylamidase substrate[1][2]. |
| Name | (2S)-2-amino-3-methyl-N-naphthalen-2-ylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Description | H-Val-βNA (L-Valine β-naphthylamide) can be used as an aminopeptidase and a Valine arylamidase substrate[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 457.9±28.0 °C at 760 mmHg |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.316 |
| Flash Point | 230.7±24.0 °C |
| Exact Mass | 242.141907 |
| PSA | 55.12000 |
| LogP | 1.95 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | OBGGZBHESVNMSA-AWEZNQCLSA-N |
| SMILES | CC(C)C(N)C(=O)Nc1ccc2ccccc2c1 |
| Storage condition | -20°C |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R40 |
| Safety Phrases | 22-36 |
| N-2-Naphthyl-L-valinamide |
| (2S)-2-amino-3-methyl-N-(naphthalen-2-yl)butanamide |
| L-Valine β-naphthylamide |
| (2S)-2-amino-3-methyl-N-(2-naphthyl)butanamide |
| Butanamide, 2-amino-3-methyl-N-2-naphthalenyl-, (2S)- |