Benzoic acid,4-(4-nitrobenzoyl)- structure
|
Common Name | Benzoic acid,4-(4-nitrobenzoyl)- | ||
|---|---|---|---|---|
| CAS Number | 7377-13-1 | Molecular Weight | 271.22500 | |
| Density | 1.413g/cm3 | Boiling Point | 509.6ºC at 760 mmHg | |
| Molecular Formula | C14H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.1ºC | |
| Name | 4-(4-nitrobenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 509.6ºC at 760 mmHg |
| Molecular Formula | C14H9NO5 |
| Molecular Weight | 271.22500 |
| Flash Point | 217.1ºC |
| Exact Mass | 271.04800 |
| PSA | 100.19000 |
| LogP | 3.04720 |
| Index of Refraction | 1.644 |
| InChIKey | FGGHZEMNYJKTDV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p-Carboxy-p'-nitro-benzophenon |