1-Benzyl-4-(N-Boc-amino)piperidine structure
|
Common Name | 1-Benzyl-4-(N-Boc-amino)piperidine | ||
|---|---|---|---|---|
| CAS Number | 73889-19-7 | Molecular Weight | 290.401 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 400.9±34.0 °C at 760 mmHg | |
| Molecular Formula | C17H26N2O2 | Melting Point | 122-125ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 196.2±25.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-Benzyl-4-(Boc-amino)piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 400.9±34.0 °C at 760 mmHg |
| Melting Point | 122-125ºC(lit.) |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.401 |
| Flash Point | 196.2±25.7 °C |
| Exact Mass | 290.199432 |
| PSA | 41.57000 |
| LogP | 3.14 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | WFKLUNLIZMWKNF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Cc2ccccc2)CC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~99%
1-Benzyl-4-(N-B... CAS#:73889-19-7 |
| Literature: IMPERIAL INNOVATIONS LIMITED; EMORY UNIVERSITY; BROWN, Robert; FUCHTER, Matthew John; CHAPMAN-ROTHE, Nadine; SRIMONGKOLPITHAK, Nitipol; CARON, Joachim; SYNDER, James; GANESH, Thota; LIU, Jin; SUN, Aiming Patent: WO2013/140148 A1, 2013 ; Location in patent: Page/Page column 65 ; |
|
~%
1-Benzyl-4-(N-B... CAS#:73889-19-7 |
| Literature: US4495194 A1, ; |
|
~%
1-Benzyl-4-(N-B... CAS#:73889-19-7 |
| Literature: US6235730 B1, ; |
|
~%
1-Benzyl-4-(N-B... CAS#:73889-19-7 |
| Literature: US5374731 A1, ; |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| 2-Methyl-2-propanyl (1-benzyl-4-piperidinyl)carbamate |
| tert-Butyl (1-benzylpiperidin-4-yl)carbamate |
| tert-butyl N-(1-benzylpiperidin-4-yl)carbamate |
| MFCD03093979 |
| Carbamic acid, N-[1-(phenylmethyl)-4-piperidinyl]-, 1,1-dimethylethyl ester |
| 1-Benzyl-4-(N-Boc-amino)piperidine |
| 1-benzyl-4-N-BOC-Aminopiperidine |
| 1-BENZYL-4-(N-BOC-AMINO)PIPERIDINE98 |