N-(4-hydroxy-2-nitro-phenyl)acetamide structure
|
Common Name | N-(4-hydroxy-2-nitro-phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 7403-75-0 | Molecular Weight | 196.16000 | |
| Density | 1.477g/cm3 | Boiling Point | 459.1ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.5ºC | |
| Name | N-(4-hydroxy-2-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.477g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760 mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16000 |
| Flash Point | 231.5ºC |
| Exact Mass | 196.04800 |
| PSA | 95.15000 |
| LogP | 1.85500 |
| Index of Refraction | 1.658 |
| InChIKey | OZZKMZSOGAOIFX-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(O)cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Acetamido-3-nitrophenol |
| 1-acetamido-4-hydroxy-2-nitrobenzene |
| 3-NITRO-4-ACETAMIDOPHENOL |
| 3-nitro 4-acetylamino phenol |
| 4-hydroxy-6-nitroacetanilide |
| 3-nitro-4-acetamino-phenol |
| 4-hydroxy-2-nitroacetanilide |