3-bromo-1-methyl-7-nitro-indazole structure
|
Common Name | 3-bromo-1-methyl-7-nitro-indazole | ||
|---|---|---|---|---|
| CAS Number | 74209-37-3 | Molecular Weight | 256.05600 | |
| Density | 1.87g/cm3 | Boiling Point | 388.286ºC at 760 mmHg | |
| Molecular Formula | C8H6BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.629ºC | |
| Name | 3-bromo-1-methyl-7-nitroindazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.87g/cm3 |
|---|---|
| Boiling Point | 388.286ºC at 760 mmHg |
| Molecular Formula | C8H6BrN3O2 |
| Molecular Weight | 256.05600 |
| Flash Point | 188.629ºC |
| Exact Mass | 254.96400 |
| PSA | 63.64000 |
| LogP | 2.76720 |
| Index of Refraction | 1.725 |
| InChIKey | HQCVNVOZRXFKNJ-UHFFFAOYSA-N |
| SMILES | Cn1nc(Br)c2cccc([N+](=O)[O-])c21 |
| HS Code | 2933990090 |
|---|
|
~37%
3-bromo-1-methy... CAS#:74209-37-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 17, # 17 p. 6180 - 6187 |
|
~90%
3-bromo-1-methy... CAS#:74209-37-3 |
| Literature: Bouissane, Latifa; El Kazzouli, Said; Leger, Jean-Michel; Jarry, Christian; Rakib, El Mostapha; Khouili, Mostafa; Guillaumet, Gerald Tetrahedron, 2005 , vol. 61, # 34 p. 8218 - 8225 |
|
~%
3-bromo-1-methy... CAS#:74209-37-3 |
| Literature: Tetrahedron, , vol. 61, # 34 p. 8218 - 8225 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Y9975 |
| 3-Brom-1-methyl-7-nitro-indazol |
| 3-Bromo-1-methyl-7-nitro-1H-indazole |
| 1H-INDAZOLE,3-BROMO-1-METHYL-7-NITRO |