Rhodamine B hydrazide structure
|
Common Name | Rhodamine B hydrazide | ||
|---|---|---|---|---|
| CAS Number | 74317-53-6 | Molecular Weight | 456.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H32N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rhodamine B hydrazideRhodamine B hydrazide is a good probe for sulfite, with colorless and non-fluorescent properties. While the emission is related to the concentration of sulfite (5-800 ng/mL; detection limit=1.4 ng/mL (3σ)). Sulfite reduces dissolved oxygen to yield superoxide radicals, which binds to Rhodamine B hydrazide to form Rhodamine B. Rhodamine B hydrazide gives Rhodamine B-like fluorescence in the presence of sulfite, which is enhanced by Tween 80 surfactant micelles. Rhodamine B hydrazide has an absorption maximum at 554 nm and a fluorescence emission maximum at 574 nm[1]. |
| Name | 2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Rhodamine B hydrazide is a good probe for sulfite, with colorless and non-fluorescent properties. While the emission is related to the concentration of sulfite (5-800 ng/mL; detection limit=1.4 ng/mL (3σ)). Sulfite reduces dissolved oxygen to yield superoxide radicals, which binds to Rhodamine B hydrazide to form Rhodamine B. Rhodamine B hydrazide gives Rhodamine B-like fluorescence in the presence of sulfite, which is enhanced by Tween 80 surfactant micelles. Rhodamine B hydrazide has an absorption maximum at 554 nm and a fluorescence emission maximum at 574 nm[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H32N4O2 |
|---|---|
| Molecular Weight | 456.58 |
| Exact Mass | 492.22900 |
| PSA | 74.51000 |
| LogP | 2.56150 |
| InChIKey | WTDHTIVYKKLOTC-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1N |
| Storage condition | 2~8°C |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | 22-37/38-41 |
| Safety Phrases | 26-36 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| RhB hydrazide |
| N-(rhodamine-B)hydrazide |
| 2-amino-3',6'-bis(diethylamino)spiro[isoindoline-1,9'-xanthen]-3-one |
| 2-amino-12,15-bis(diethylamino)spiro[isoindoline-3,9'-xanthene]-1-one |
| hydrazine rhodamine |
| N-(rhodamine-B) lactam-hydrazine |
| Rhodamine B hydrazide |