Solvent Red 49 structure
|
Common Name | Solvent Red 49 | ||
|---|---|---|---|---|
| CAS Number | 509-34-2 | Molecular Weight | 442.54900 | |
| Density | 1.24 g/cm3 | Boiling Point | 637.2ºC at 760 mmHg | |
| Molecular Formula | C28H30N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | Rhodamine B base |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24 g/cm3 |
|---|---|
| Boiling Point | 637.2ºC at 760 mmHg |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.54900 |
| Exact Mass | 442.22600 |
| PSA | 59.52000 |
| LogP | 4.22630 |
| Index of Refraction | 1.652 |
| InChIKey | DZNJMLVCIZGWSC-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21OC(=O)c2ccccc21 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R37/38;R41 |
| Safety Phrases | S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 208-096-8 |
| MFCD00066967 |
| Solvent Red 49 |