Solvent Red 49
Solvent Red 49 structure
|
Common Name | Solvent Red 49 | ||
|---|---|---|---|---|
| CAS Number | 509-34-2 | Molecular Weight | 442.54900 | |
| Density | 1.24 g/cm3 | Boiling Point | 637.2ºC at 760 mmHg | |
| Molecular Formula | C28H30N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Rhodamine B base |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.24 g/cm3 |
|---|---|
| Boiling Point | 637.2ºC at 760 mmHg |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.54900 |
| Exact Mass | 442.22600 |
| PSA | 59.52000 |
| LogP | 4.22630 |
| Index of Refraction | 1.652 |
| InChIKey | DZNJMLVCIZGWSC-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21OC(=O)c2ccccc21 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R37/38;R41 |
| Safety Phrases | S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 3 | |
CAS#:81-88-9
CAS#:3375-25-5
CAS#:528-46-1
CAS#:91-68-9![2-[4-(Diethylamino)-2-hydroxybenzoyl]benzoic acid Structure](https://image.chemsrc.com/caspic/213/5809-23-4.png)
CAS#:5809-23-4
CAS#:109-89-7
CAS#:74317-53-6![Spiro[1H-isoindole-1,9'-[9H]xanthen]-3(2H)-one,3',6'-bis(diethylamino)-2-phenyl structure](https://image.chemsrc.com/caspic/227/38660-35-4.png)
CAS#:38660-35-4This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 208-096-8 |
| MFCD00066967 |
| Solvent Red 49 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does Rhodamine B base have? |
| A: English synonyms of Rhodamine B base: EINECS 208-096-8, MFCD00066967, Solvent Red 49. |
| Q: What is the safety information for Rhodamine B base? |
| A: Safety information for Rhodamine B base: S26-S36/37. |
| Q: What are the downstream products of Rhodamine B base? |
| A: Related downstream products(CAS) of Rhodamine B base: 5809-23-4;74317-53-6;38660-35-4. |
| Q: What is the boiling point of Rhodamine B base? |
| A: Boiling point of Rhodamine B base is 637.2ºC at 760 mmHg. |
| Q: What is the SMILES notation of Rhodamine B base? |
| A: SMILES notation of Rhodamine B base is CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21OC(=O)c2ccccc21. |
| Q: What is the InChIKey of Rhodamine B base? |
| A: InChIKey of Rhodamine B base is DZNJMLVCIZGWSC-UHFFFAOYSA-N. |
| Q: What is the CAS number of Rhodamine B base? |
| A: CAS number of Rhodamine B base is 509-34-2. |
| Q: What is the molecular formula of Rhodamine B base? |
| A: Molecular formula of Rhodamine B base is C28H30N2O3. |
| Q: What is the English name of Rhodamine B base? |
| A: The English name of Rhodamine B base is Rhodamine B base. |
| Q: What is the molecular weight of Rhodamine B base? |
| A: Molecular weight of Rhodamine B base is 442.54900. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |