2-methylbutan-2-yl N-(3-chlorophenyl)carbamate structure
|
Common Name | 2-methylbutan-2-yl N-(3-chlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 7460-24-4 | Molecular Weight | 241.71400 | |
| Density | 1.168g/cm3 | Boiling Point | 281.8ºC at 760 mmHg | |
| Molecular Formula | C12H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.2ºC | |
| Name | tert-pentyl (3-chlorophenyl)carbamate |
|---|
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 281.8ºC at 760 mmHg |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.71400 |
| Flash Point | 124.2ºC |
| Exact Mass | 241.08700 |
| PSA | 38.33000 |
| LogP | 4.15010 |
| Index of Refraction | 1.547 |
| InChIKey | PXKLJLHBYKBEHS-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)OC(=O)Nc1cccc(Cl)c1 |
|
~%
2-methylbutan-2... CAS#:7460-24-4 |
| Literature: Francis,T.; Thorne,M.P. Canadian Journal of Chemistry, 1976 , vol. 54, p. 24 - 30 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |