1h,1h,2h,2h-perfluorodecyldimethylchlorosilane structure
|
Common Name | 1h,1h,2h,2h-perfluorodecyldimethylchlorosilane | ||
|---|---|---|---|---|
| CAS Number | 74612-30-9 | Molecular Weight | 540.71900 | |
| Density | 1,51 g/cm3 | Boiling Point | 197 °C | |
| Molecular Formula | C12H10ClF17Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >65°C | |
| Name | chloro-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1,51 g/cm3 |
|---|---|
| Boiling Point | 197 °C |
| Molecular Formula | C12H10ClF17Si |
| Molecular Weight | 540.71900 |
| Flash Point | >65°C |
| Exact Mass | 539.99700 |
| LogP | 7.82980 |
| Index of Refraction | 1.3415 |
| InChIKey | JHCJWHBMXWOYDE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S28-S36/37/39-S45 |
| RIDADR | 2987 |
| Packaging Group | II |
| Hazard Class | 8 |
|
~66%
1h,1h,2h,2h-per... CAS#:74612-30-9 |
| Literature: Ameduri, B.; Boutevin, B.; Nouiri, M.; Talbi, M. Journal of Fluorine Chemistry, 1995 , vol. 74, # 2 p. 191 - 198 |
|
~%
1h,1h,2h,2h-per... CAS#:74612-30-9 |
| Literature: Journal of Fluorine Chemistry, , vol. 74, # 2 p. 191 - 198 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| MFCD00042343 |
| perfluorodecyl-1H,1H,2H,2H-dimethylchlorosilane |
| 1H,1H,2H,2H-Perfluorodecyldimethylchlorosilane |