2,8-dichloro-N,N-dimethyl-5H-purin-6-amine structure
|
Common Name | 2,8-dichloro-N,N-dimethyl-5H-purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 7474-71-7 | Molecular Weight | 232.07000 | |
| Density | 1.72g/cm3 | Boiling Point | 306.5ºC at 760 mmHg | |
| Molecular Formula | C7H7Cl2N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.2ºC | |
| Name | 2,8-dichloro-N,N-dimethyl-7H-purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 306.5ºC at 760 mmHg |
| Molecular Formula | C7H7Cl2N5 |
| Molecular Weight | 232.07000 |
| Flash Point | 139.2ºC |
| Exact Mass | 231.00800 |
| PSA | 57.70000 |
| LogP | 1.72570 |
| Index of Refraction | 1.746 |
| InChIKey | LTBDRQYSEFOMQD-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(Cl)nc2nc(Cl)[nH]c12 |
|
~%
2,8-dichloro-N,... CAS#:7474-71-7 |
| Literature: Breshears et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3789,3790 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2,8-dichloro-7(9)H-purin-6-yl)-dimethyl-amine |
| (2,8-Dichlor-7(9)H-purin-6-yl)-dimethyl-amin |