4,4'-Vinylidene-bis-(N,N-dimethylaniline) structure
|
Common Name | 4,4'-Vinylidene-bis-(N,N-dimethylaniline) | ||
|---|---|---|---|---|
| CAS Number | 7478-69-5 | Molecular Weight | 266.38100 | |
| Density | 1.033g/cm3 | Boiling Point | 420.2ºC at 760 mmHg | |
| Molecular Formula | C18H22N2 | Melting Point | 119-121ºC(lit.) | |
| MSDS | N/A | Flash Point | 189.6ºC | |
| Name | 4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.033g/cm3 |
|---|---|
| Boiling Point | 420.2ºC at 760 mmHg |
| Melting Point | 119-121ºC(lit.) |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.38100 |
| Flash Point | 189.6ºC |
| Exact Mass | 266.17800 |
| PSA | 6.48000 |
| LogP | 3.88010 |
| Index of Refraction | 1.605 |
| InChIKey | HBWITNNIJDLPLS-UHFFFAOYSA-N |
| SMILES | C=C(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
| Hazard Codes | T |
|---|---|
| Risk Phrases | 45-46-20/21/22-36/37/38 |
| Safety Phrases | 53-23-26-36/37/39-45 |
| HS Code | 2921590090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Michlerhs ethylene |
| Michler's ethylene |
| EINECS 231-284-6 |