2-(3-chlorobenzoyl)naphthalene-1-carboxylic acid structure
|
Common Name | 2-(3-chlorobenzoyl)naphthalene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 7496-01-7 | Molecular Weight | 310.73100 | |
| Density | 1.374g/cm3 | Boiling Point | 560.4ºC at 760 mmHg | |
| Molecular Formula | C18H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.7ºC | |
| Name | 2-(3-chlorobenzoyl)naphthalene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 560.4ºC at 760 mmHg |
| Molecular Formula | C18H11ClO3 |
| Molecular Weight | 310.73100 |
| Flash Point | 292.7ºC |
| Exact Mass | 310.04000 |
| PSA | 54.37000 |
| LogP | 4.42240 |
| Index of Refraction | 1.682 |
| InChIKey | DZQRZWOTZKTNGP-UHFFFAOYSA-N |
| SMILES | O=C(c1cccc(Cl)c1)c1ccc2ccccc2c1C(=O)O |
|
~%
2-(3-chlorobenz... CAS#:7496-01-7 |
| Literature: Newman; Orchin Journal of the American Chemical Society, 1939 , vol. 61, p. 244,245 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(3-Chlor-benzoyl)-[1]naphthoesaeure |
| 2-(3-chloro-benzoyl)-[1]naphthoic acid |