Boc-NH-PEG4-CH2CH2COOH structure
|
Common Name | Boc-NH-PEG4-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 756525-91-4 | Molecular Weight | 365.419 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 504.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H31NO8 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 258.9±30.1 °C | |
Use of Boc-NH-PEG4-CH2CH2COOHBoc-NH-PEG4-CH2CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTAC[1]. Boc-NH-PEG4-CH2CH2COOH is also a cleavable ADC linker used as a linker for antibody-drug conjugates (ADC)[2]. |
| Name | 3-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-NH-PEG4-CH2CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTAC[1]. Boc-NH-PEG4-CH2CH2COOH is also a cleavable ADC linker used as a linker for antibody-drug conjugates (ADC)[2]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 504.5±50.0 °C at 760 mmHg |
| Molecular Formula | C16H31NO8 |
| Molecular Weight | 365.419 |
| Flash Point | 258.9±30.1 °C |
| Exact Mass | 365.204956 |
| PSA | 112.55000 |
| LogP | -0.14 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | YEIYIPDFZMLJQH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCC(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| 15-T-BUTYLOXYCARBONYLAMINO-4,7,10,13-TETRAOXA-PENTADECANOIC ACID |
| 2,2-Dimethyl-4-oxo-3,8,11,14,17-pentaoxa-5-azaicosan-20-oic acid |
| 3,8,11,14,17-Pentaoxa-5-azaeicosan-20-oic acid, 2,2-dimethyl-4-oxo- |
| AmbotzPEG1920 |