(6aS,11bR)-6a,11b-Dihydro-5,6a,9-trihydroxy-2,2-dimethyl-11b-(3-methyl-2-butenyl)-2H,6H-benzofuro[3,2-b]pyrano[3,2-g][1]benzopyran-6-one structure
|
Common Name | (6aS,11bR)-6a,11b-Dihydro-5,6a,9-trihydroxy-2,2-dimethyl-11b-(3-methyl-2-butenyl)-2H,6H-benzofuro[3,2-b]pyrano[3,2-g][1]benzopyran-6-one | ||
|---|---|---|---|---|
| CAS Number | 76464-71-6 | Molecular Weight | 436.45 | |
| Density | 1.397g/cm3 | Boiling Point | 668.8ºC at 760 mmHg | |
| Molecular Formula | C25H24O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.6ºC | |
Use of (6aS,11bR)-6a,11b-Dihydro-5,6a,9-trihydroxy-2,2-dimethyl-11b-(3-methyl-2-butenyl)-2H,6H-benzofuro[3,2-b]pyrano[3,2-g][1]benzopyran-6-oneSanggenon A (Sanggenone A) exerts anti-inflammatory effects by regulating NF-κB and HO-1/Nrf2 signaling pathways in BV2 and RAW264.7 cells. Sanggenon A markedly inhibits the Lipopolysaccharide (LPS; HY-D1056)-induced production of nitric oxide[1]. |
| Name | sanggenon A |
|---|
| Description | Sanggenon A (Sanggenone A) exerts anti-inflammatory effects by regulating NF-κB and HO-1/Nrf2 signaling pathways in BV2 and RAW264.7 cells. Sanggenon A markedly inhibits the Lipopolysaccharide (LPS; HY-D1056)-induced production of nitric oxide[1]. |
|---|---|
| Related Catalog | |
| Target |
NF-κB |
| References |
| Density | 1.397g/cm3 |
|---|---|
| Boiling Point | 668.8ºC at 760 mmHg |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.45 |
| Flash Point | 231.6ºC |
| Exact Mass | 436.15200 |
| PSA | 105.45000 |
| LogP | 4.18990 |
| Index of Refraction | 1.66 |
| InChIKey | WDKDKBZGSVJWSD-JWQCQUIFSA-N |
| SMILES | CC(C)=CCC12Oc3cc4c(c(O)c3C(=O)C1(O)Oc1cc(O)ccc12)C=CC(C)(C)O4 |