MRS-2500 structure
|
Common Name | MRS-2500 | ||
|---|---|---|---|---|
| CAS Number | 779323-43-2 | Molecular Weight | 629.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H30IN9O8P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MRS-2500A highly potent and selective antagonist of the platelet P2Y1 receptor with Ki of 0.78 nM. |
| Name | MRS 2500 tetraammonium salt,(1R*,2S*)-4-[2-Iodo-6-(methylamino)-9H-purin-9-yl]-2-(phosphonooxy)bicyclo[3.1.0]hexane-1-methanoldihydrogenphosphateestertetraammoniumsalt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H30IN9O8P2 |
|---|---|
| Molecular Weight | 629.28500 |
| Exact Mass | 629.07400 |
| PSA | 221.73000 |
| LogP | 2.37950 |
| InChIKey | NMVWLEUONAKGCD-SMWKGLLFSA-N |
| SMILES | CNc1nc(I)nc2c1ncn2C1CC(OP(=O)(O)O)C2(COP(=O)(O)O)CC12 |
| mrs 2500 tetraammonium salt |