Biphenyl dimethyl dicarboxylate structure
|
Common Name | Biphenyl dimethyl dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 792-74-5 | Molecular Weight | 270.280 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 407.0±38.0 °C at 760 mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | 213-215 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 204.7±25.2 °C | |
Use of Biphenyl dimethyl dicarboxylateDimethyl biphenyl-4,4'-dicarboxylate (Biphenyl dimethyl dicarboxylate) is a hepatoprotectant obtained from Schizandra fructus and may induce a signal transduction similar to that associated with IFN[1]. |
| Name | Dimethyl biphenyl-4,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Dimethyl biphenyl-4,4'-dicarboxylate (Biphenyl dimethyl dicarboxylate) is a hepatoprotectant obtained from Schizandra fructus and may induce a signal transduction similar to that associated with IFN[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.0±38.0 °C at 760 mmHg |
| Melting Point | 213-215 °C(lit.) |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.280 |
| Flash Point | 204.7±25.2 °C |
| Exact Mass | 270.089203 |
| PSA | 52.60000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | BKRIRZXWWALTPU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(-c2ccc(C(=O)OC)cc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917399090 |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Synthesis and properties of luminophores derived from fluorinated biphenyls. Ol'khovik VK, et al.
Russ. J. Org. Chem. 44(8) , 1172-79, (2008)
|
|
|
Dimethyl biphenyl-4, 4'-dicarboxylate. Ritzerfeld V, et al.
Acta Crystallogr. Sect. E Struct. Rep. Online 65(7) , 1677, (2009)
|
| EINECS 212-341-4 |
| MFCD00017201 |
| Dimethyl (1,1'-biphenyl)-4,4'-dicarboxylate |
| Dimethyl biphenyl-4,4'-dicarboxylate |
| (1,1'-Biphenyl)-4,4'-dicarboxylic acid, dimethyl ester |
| Biphenyl dimethyl dicarboxylate |
| Dimethyl 4,4'-biphenyldicarboxylate |
| methyl 4-(4-methoxycarbonylphenyl)benzoate |
| [1,1'-Biphenyl]-4,4'-dicarboxylic acid, dimethyl ester |
| 4,4'-Biphenyldicarboxylic acid, dimethyl ester |