AFP-07 free acid structure
|
Common Name | AFP-07 free acid | ||
|---|---|---|---|---|
| CAS Number | 788799-13-3 | Molecular Weight | 412.467 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 557.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H30F2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1±30.1 °C | |
Use of AFP-07 free acidAFP 07 free acid is a 7,7-difluoroprostacyclin derivative that acts as a selective and highly potent agonist for the IP receptor. Prostaglandin I2 is an unstable prostanoid which, through the ‘I prostanoid’ (IP) receptor, inhibits platelet aggregation and promotes vasodilatation in pulmonary vascular beds. |
| Name | (5Z)-5-[(3aR,4R,5R,6aS)-3,3-difluoro-5-hydroxy-4-[(E,3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 557.8±50.0 °C at 760 mmHg |
| Molecular Formula | C22H30F2O5 |
| Molecular Weight | 412.467 |
| Flash Point | 291.1±30.1 °C |
| Exact Mass | 412.206116 |
| PSA | 86.99000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | PVHIRYQSPDZLLG-JFEAKWICSA-N |
| SMILES | CCC#CCC(C)C(O)C=CC1C(O)CC2OC(=CCCCC(=O)O)C(F)(F)C21 |
| AFP-07 free acid |
| (5Z)-5-{(3aR,4R,5R,6aS)-3,3-Difluoro-5-hydroxy-4-[(1E,3S,4S)-3-hydroxy-4-methyl-1-nonen-6-yn-1-yl]hexahydro-2H-cyclopenta[b]furan-2-ylidene}pentanoic acid |
| UNII-69PPR64XJA |
| (5Z)-5-{(3aR,4R,5R,6aS)-3,3-Difluoro-5-hydroxy-4-[(1E,3S,4S)-3-hydroxy-4-methyl-1-nonen-6-yn-1-yl]hexahydro-2H-cyclopenta[b]furan-2-ylidene}pentanoic acid (non-preferred name) |