3β-Ursodeoxycholic acid structure
|
Common Name | 3β-Ursodeoxycholic acid | ||
|---|---|---|---|---|
| CAS Number | 78919-26-3 | Molecular Weight | 392.57200 | |
| Density | 1.128g/cm3 | Boiling Point | 547.1ºC at 760 mmHg | |
| Molecular Formula | C24H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.8ºC | |
Use of 3β-Ursodeoxycholic acid3β-Ursodeoxycholic acid (Isoursodeoxycholic acid) is a bile acid. 3β-Ursodeoxycholic acid (Isoursodeoxycholic acid) shows good tolerance and well intestinal absorption by oral adminstation. 3β-Ursodeoxycholic acid (Isoursodeoxycholic acid) can be isomerized by intestinal and hepatic enzymes to yield UDCA[1]. |
| Name | isoursodeoxycholic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3β-Ursodeoxycholic acid (Isoursodeoxycholic acid) is a bile acid. 3β-Ursodeoxycholic acid (Isoursodeoxycholic acid) shows good tolerance and well intestinal absorption by oral adminstation. 3β-Ursodeoxycholic acid (Isoursodeoxycholic acid) can be isomerized by intestinal and hepatic enzymes to yield UDCA[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 547.1ºC at 760 mmHg |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.57200 |
| Flash Point | 298.8ºC |
| Exact Mass | 392.29300 |
| PSA | 77.76000 |
| LogP | 4.47790 |
| Index of Refraction | 1.543 |
| InChIKey | RUDATBOHQWOJDD-DNMBCGTGSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C |
| Hazard Codes | T |
|---|
| sodium chenodexoycholate |
| sodium sat of chenodeoxycholic acid |
| sodiumchenodesoxycholate |
| chenodesoxycholate de sodium |
| sodium chenodeoxycholate |
| Chenodeoxycholate sodium salt |
| (3β,5β,7β)-3,7-Dihydroxycholan-24-oic acid |
| Chenodeoxycholic Saeure |
| Chenodiol Chenodesoxycholic acid |
| cenodeoxycholate |
| chenodeoxycholic acid sodium salt |