NDM-1 inhibitor-1 structure
|
Common Name | NDM-1 inhibitor-1 | ||
|---|---|---|---|---|
| CAS Number | 80570-90-7 | Molecular Weight | 233.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NDM-1 inhibitor-1NDM-1 inhibitor-1 is an inhibitor of new delhi metallo-β-lactamase-1 (NDM-1). New Delhi Metallo-β-Lactamase-1 (NDM-1) has drawn great attention due to its diverse antibiotic resistant activity. |
| Name | 4-allyl-5-(2-hydroxyphenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11N3OS |
|---|---|
| Molecular Weight | 233.29000 |
| Exact Mass | 233.06200 |
| PSA | 85.93000 |
| LogP | 2.49930 |
| InChIKey | KZAQFAGWXZOUIA-UHFFFAOYSA-N |
| SMILES | C=CCn1c(-c2ccccc2O)n[nH]c1=S |
| 4-Allyl-5-(2-hydroxy-phenyl)-2,4-dihydro-[1,2,4]triazole-3-thione |
| 5-(o-hydroxyphenyl)-4-allyl-1,2,4-triazole-3-thione |