DTSSP Crosslinker structure
|
Common Name | DTSSP Crosslinker | ||
|---|---|---|---|---|
| CAS Number | 81069-02-5 | Molecular Weight | 564.54200 | |
| Density | 1.94 | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O14S4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of DTSSP CrosslinkerDTSSP Crosslinker is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | 3,3'-Dithiobis(sulfosuccinimidylpropionate) |
|---|---|
| Synonym | More Synonyms |
| Description | DTSSP Crosslinker is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Density | 1.94 |
|---|---|
| Molecular Formula | C14H16N2O14S4 |
| Molecular Weight | 564.54200 |
| Exact Mass | 563.94800 |
| PSA | 303.46000 |
| LogP | 0.13240 |
| Index of Refraction | 1.693 |
| InChIKey | VOTJUWBJENROFB-UHFFFAOYSA-N |
| SMILES | O=C(CCSSCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| N,N'-dioctyl-3,3'-disulfanediyl-bis-propionamide |
| N,N'-Bis-n-octyl-3,3'-dithiopropionamide |
| 3,3'-disulfanediylbis(N-octylpropanamide) |
| 3,3-dithiobis(sulfosuccinimidyl propionate) |
| N,N'-di-n-octyl-3,3'-dithiodipropionamide |
| N,N'-Di-n-octyl-3,3'-dithiodipropionamid |
| Propanamide,3,3'-dithiobis[N-octyl |
| (SCH2CH2CONHC8H17)2 |
| 3,3'-dithiobis(N-octylpropionamide) |