Benzyl 2,2,2-trichloroacetimidate structure
|
Common Name | Benzyl 2,2,2-trichloroacetimidate | ||
|---|---|---|---|---|
| CAS Number | 81927-55-1 | Molecular Weight | 252.525 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 319.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C9H8Cl3NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 107.0±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Benzyl 2,2,2-Trichloroacetimidate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 319.5±0.0 °C at 760 mmHg |
| Molecular Formula | C9H8Cl3NO |
| Molecular Weight | 252.525 |
| Flash Point | 107.0±30.1 °C |
| Exact Mass | 250.967148 |
| PSA | 33.08000 |
| LogP | 3.51 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | HUZCTWYDQIQZPM-UHFFFAOYSA-N |
| SMILES | N=C(OCc1ccccc1)C(Cl)(Cl)Cl |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925290090 |
|
~95%
Benzyl 2,2,2-tr... CAS#:81927-55-1 |
| Literature: Patil, Vijay J. Tetrahedron Letters, 1996 , vol. 37, # 9 p. 1481 - 1484 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Tetrahedron Asymmetry 3 , 1547, (1992)
|
|
|
Studies of novel cyclitols. A synthesis of 3'O, 4'O -dimethylfuniculosin. Williams DR, et al.
Tetrahedron Lett. 41(49) , 9397-9401, (2000)
|
|
|
The total synthesis of scytophycin C. Part 1: stereocontrolled synthesis of the C1? C32 protected seco acid. Paterson I, et al.
Tetrahedron 54(39) , 11935-11954, (1998)
|
| Benzyl 2,2,2-trichloroethanimidate |
| Ethanimidic acid, 2,2,2-trichloro-, phenylmethyl ester |
| MFCD00000805 |
| Benzyl 2,2,2-trichloroethanimidoate |
| BENZYL TRICHLOROACETIMIDATE |