9(Z),11(Z)-Conjugated Linoleic Acid methyl ester structure
|
Common Name | 9(Z),11(Z)-Conjugated Linoleic Acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 822-10-6 | Molecular Weight | 294.47200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 9(Z),11(Z)-Conjugated Linoleic Acid methyl ester9(Z),11(Z)-Conjugated linoleic acid methyl ester has been used as a standard for the quantification of conjugated linoleic acid methyl esters by GC-MS. |
| Name | Me 9c,11t-CLA |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H34O2 |
|---|---|
| Molecular Weight | 294.47200 |
| Exact Mass | 294.25600 |
| PSA | 26.30000 |
| LogP | 5.97290 |
| InChIKey | KVIWYYOMPLJRMC-XESWYYRISA-N |
| SMILES | CCCCCCC=CC=CCCCCCCCC(=O)OC |
| 9Z,11E-conjugated linoleic acid methyl ester |
| (9Z,11E)-methyl octadeca-9,11-dienoate |
| methyl 9(Z),11(E)-octadecadienoate |
| methyl cis,trans-9,11-octadecadienoate |
| methyl cis-9,trans-11-octadecadienoate |
| methyl 9-cis,11-trans-octadecadienoate |