Boc-D-4-Trifluoromethylphe structure
|
Common Name | Boc-D-4-Trifluoromethylphe | ||
|---|---|---|---|---|
| CAS Number | 82317-83-7 | Molecular Weight | 333.303 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 431.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H18F3NO4 | Melting Point | 135-140ºC | |
| MSDS | USA | Flash Point | 214.7±28.7 °C | |
| Name | Boc-4-(trifluoromethyl)-D-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.4±45.0 °C at 760 mmHg |
| Melting Point | 135-140ºC |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.303 |
| Flash Point | 214.7±28.7 °C |
| Exact Mass | 333.118805 |
| PSA | 75.63000 |
| LogP | 3.54 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | SMVCCWNHCHCWAZ-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(C(F)(F)F)cc1)C(=O)O |
| Storage condition | Keep Cold |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~79%
Boc-D-4-Trifluo... CAS#:82317-83-7 |
| Literature: REMPEX PHARMACEUTICALS, INC.; GLINKA, Tomasz; HIGUCHI, Robert; HECKER, Scott; EASTMAN, Brian; RODNY, Olga Patent: WO2012/109164 A1, 2012 ; Location in patent: Page/Page column 53-54 ; WO 2012/109164 A1 |
|
~85%
Boc-D-4-Trifluo... CAS#:82317-83-7 |
| Literature: Nestor Jr.; Ho; Simpson; Horner; Jones; McRae; Vickery Journal of Medicinal Chemistry, 1982 , vol. 25, # 7 p. 795 - 801 |
|
~%
Boc-D-4-Trifluo... CAS#:82317-83-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 20, # 19 p. 5607 - 5612 |
|
~%
Boc-D-4-Trifluo... CAS#:82317-83-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 25, # 7 p. 795 - 801 |
|
~%
Boc-D-4-Trifluo... CAS#:82317-83-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 25, # 7 p. 795 - 801 |
|
~%
Boc-D-4-Trifluo... CAS#:82317-83-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 25, # 7 p. 795 - 801 |
|
~%
Boc-D-4-Trifluo... CAS#:82317-83-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 25, # 7 p. 795 - 801 |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-L-phenylalanine |
| MFCD00797557 |
| BOC-D-4-Trifluoromethylphe |
| (2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| N-(tert-Butoxycarbonyl)-4-(trifluormethyl)-L-phenylalanin |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine |
| D-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-4-(trifluoromethyl)- |
| N-(tert-Butoxycarbonyl)-4-(trifluormethyl)-D-phenylalanin |
| Boc-D-phe(4-CF3)-OH |
| (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-4-(trifluoromethyl)- |
| N-(tert-Butoxycarbonyl)-4-(trifluoromethyl)-L-phenylalanine |
| N-(tert-Butoxycarbonyl)-4-(trifluoromethyl)-D-phenylalanine |
| Boc-D-Phe(4-CF3)-OH.HCl |