4,4'-DDA structure
|
Common Name | 4,4'-DDA | ||
|---|---|---|---|---|
| CAS Number | 83-05-6 | Molecular Weight | 281.13400 | |
| Density | 1.373g/cm3 | Boiling Point | 411.4ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | 167-169ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 202.6ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Warning | |
| Name | bis(4-chlorophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 411.4ºC at 760 mmHg |
| Melting Point | 167-169ºC(lit.) |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.13400 |
| Flash Point | 202.6ºC |
| Exact Mass | 280.00600 |
| PSA | 37.30000 |
| LogP | 4.20990 |
| Index of Refraction | 1.616 |
| InChIKey | YIOCIFXUGBYCJR-UHFFFAOYSA-N |
| SMILES | O=C(O)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H351 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | 7-22-36-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | AF5475000 |
| HS Code | 2916399090 |
| Precursor 8 | |
|---|---|
| DownStream 8 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Mitotane (1-(o-chlorophenyl)-1-(p-chlorophenyl)-2,2-dichloroethane) metabolism in perfusion studies with dog adrenal glands.
Drug Metab. Dispos. 15(2) , 267-9, (1987)
|
|
|
Oxidation at C-1 controls the cytotoxicity of 1,1-dichloro-2,2- bis(p-chlorophenyl)ethane by rabbit and human lung cells.
Drug Metab. Dispos. 23(5) , 595-9, (1995) Isolated rabbit Clara cells and a transformed human bronchial epithelial cell line, BEAS-2B, were used to investigate the mechanism of cytotoxicity of 1,1-dichloro-2,2-bis(p-chlorophenyl)ethane (DDD),... |
|
|
Development of an enzyme-linked immunosorbent assay for the quantification of DDA (2,2-bis(p-chlorophenyl) acetic acid) in urine.
Bull. Environ. Contam. Toxicol. 38(5) , 798-804, (1987)
|
| EINECS 201-451-8 |
| MFCD00004248 |
| Bis(4-chlorophenyl)acetic Acid |