beta-d-glucose pentaacetate
beta-d-glucose pentaacetate structure
|
Common Name | beta-d-glucose pentaacetate | ||
|---|---|---|---|---|
| CAS Number | 83-87-4 | Molecular Weight | 390.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22O11 | Melting Point | 130-132ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 130-132ºC |
|---|---|
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.33900 |
| Exact Mass | 390.11600 |
| PSA | 140.73000 |
| InChIKey | LPTITAGPBXDDGR-IWQYDBTJSA-N |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| Storage condition | 0-6°C |
| Water Solubility | chloroform: 0.1 g/mL, clear, colorless |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Safety Phrases | S24/25 |
|---|---|
| WGK Germany | 3 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 10 | |
CAS#:106927-48-4
CAS#:129411-62-7
CAS#:26255-70-9
CAS#:4098-06-0
CAS#:3366-47-0
CAS#:34272-02-1
CAS#:34213-86-0
CAS#:492-93-3
CAS#:35599-02-1
CAS#:38954-67-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00006597 |
| EINECS 210-074-8 |
| Peracetylglucose |
| Pentaacetyl-dextro-glucose |
| 1,2,3,4,6-Pentaacetyl-D-glucose |
| Penta-O-acetyl-D-glucopyranose |
| 1,2,3,4,6-Penta-O-acetyl-D-glucopyranose |
| D-Glucopyranose,pentaacetate |
| Pentaacetyl-D-glucose |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate? |
| A: Molecular weight of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate is 390.33900. |
| Q: What is the polar surface area (PSA) of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate? |
| A: Polar surface area (PSA) of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate is 140.73000. |
| Q: What are the storage conditions for [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate? |
| A: Storage conditions for [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate: 0-6°C. |
| Q: What is the CAS number of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate? |
| A: CAS number of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate is 83-87-4. |
| Q: What English synonyms does [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate have? |
| A: English synonyms of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate: MFCD00006597, EINECS 210-074-8, Peracetylglucose, Pentaacetyl-dextro-glucose, 1,2,3,4,6-Pentaacetyl-D-glucose, Penta-O-acetyl-D-glucopyranose, 1,2,3,4,6-Penta-O-acetyl-D-glucopyranose, D-Glucopyranose,pentaacetate, Pentaacetyl-D-glucose. |
| Q: What are the downstream products of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate? |
| A: Related downstream products(CAS) of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate: 106927-48-4;129411-62-7;26255-70-9;4098-06-0;3366-47-0;34272-02-1;34213-86-0;492-93-3;35599-02-1;38954-67-5. |
| Q: What is the molecular formula of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate? |
| A: Molecular formula of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate is C16H22O11. |
| Q: What is the InChIKey of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate? |
| A: InChIKey of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate is LPTITAGPBXDDGR-IWQYDBTJSA-N. |
| Q: What is the English name of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate? |
| A: The English name of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate is [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate. |
| Q: What is the melting point of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate? |
| A: Melting point of [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate is 130-132ºC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |