p-Nitrophenyl β-D-Cellotrioside
p-Nitrophenyl β-D-Cellotrioside structure
|
Common Name | p-Nitrophenyl β-D-Cellotrioside | ||
|---|---|---|---|---|
| CAS Number | 106927-48-4 | Molecular Weight | 625.53100 | |
| Density | 1.75g/cm3 | Boiling Point | 971ºC at 760 mmHg | |
| Molecular Formula | C24H35NO18 | Melting Point | 246-248ºC dec. | |
| MSDS | N/A | Flash Point | 541.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | p-Nitrophenyl β-D-Cellotrioside |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 971ºC at 760 mmHg |
| Melting Point | 246-248ºC dec. |
| Molecular Formula | C24H35NO18 |
| Molecular Weight | 625.53100 |
| Flash Point | 541.1ºC |
| Exact Mass | 625.18500 |
| PSA | 303.50000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | BETIRLUWOMCBBJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OC2OC(CO)C(OC3OC(CO)C(OC4OC(CO)C(O)C(O)C4O)C(O)C3O)C(O)C2O)cc1 |
| Storage condition | −20°C |
| Stability | Store in Freezer |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| WGK Germany | 3 |
|---|---|
| HS Code | 29389090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 2 | |
CAS#:3482-57-3
CAS#:2106-10-7
CAS#:2492-87-7
CAS#:83-87-4
CAS#:5987-78-0
CAS#:100-02-7
CAS#:604-69-3
CAS#:69948-03-4
CAS#:5328-50-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-[6-[4,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of p-Nitrophenyl β-D-Cellotrioside? |
| A: SMILES notation of p-Nitrophenyl β-D-Cellotrioside is O=[N+]([O-])c1ccc(OC2OC(CO)C(OC3OC(CO)C(OC4OC(CO)C(O)C(O)C4O)C(O)C3O)C(O)C2O)cc1. |
| Q: What are the storage conditions for p-Nitrophenyl β-D-Cellotrioside? |
| A: Storage conditions for p-Nitrophenyl β-D-Cellotrioside: −20°C. |
| Q: What is the molecular formula of p-Nitrophenyl β-D-Cellotrioside? |
| A: Molecular formula of p-Nitrophenyl β-D-Cellotrioside is C24H35NO18. |
| Q: What is the molecular weight of p-Nitrophenyl β-D-Cellotrioside? |
| A: Molecular weight of p-Nitrophenyl β-D-Cellotrioside is 625.53100. |
| Q: What is the English name of p-Nitrophenyl β-D-Cellotrioside? |
| A: The English name of p-Nitrophenyl β-D-Cellotrioside is p-Nitrophenyl β-D-Cellotrioside. |
| Q: What is the boiling point of p-Nitrophenyl β-D-Cellotrioside? |
| A: Boiling point of p-Nitrophenyl β-D-Cellotrioside is 971ºC at 760 mmHg. |
| Q: What is the CAS number of p-Nitrophenyl β-D-Cellotrioside? |
| A: CAS number of p-Nitrophenyl β-D-Cellotrioside is 106927-48-4. |
| Q: What English synonyms does p-Nitrophenyl β-D-Cellotrioside have? |
| A: English synonyms of p-Nitrophenyl β-D-Cellotrioside: 2-[6-[4,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol. |
| Q: What is the polar surface area (PSA) of p-Nitrophenyl β-D-Cellotrioside? |
| A: Polar surface area (PSA) of p-Nitrophenyl β-D-Cellotrioside is 303.50000. |
| Q: What is the melting point of p-Nitrophenyl β-D-Cellotrioside? |
| A: Melting point of p-Nitrophenyl β-D-Cellotrioside is 246-248ºC dec. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |