2-Amino-4-tert-amyl-6-nitrophenol structure
|
Common Name | 2-Amino-4-tert-amyl-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 83488-02-2 | Molecular Weight | 224.25600 | |
| Density | 1.211 g/cm3 | Boiling Point | 324.8ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O3 | Melting Point | 200 °C | |
| MSDS | N/A | Flash Point | 150.3ºC | |
| Name | 4-tert-Amyl-2-amino-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211 g/cm3 |
|---|---|
| Boiling Point | 324.8ºC at 760 mmHg |
| Melting Point | 200 °C |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.25600 |
| Flash Point | 150.3ºC |
| Exact Mass | 224.11600 |
| PSA | 92.07000 |
| LogP | 3.67460 |
| Index of Refraction | 1.583 |
| InChIKey | WLJLENRIPLYJSZ-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1cc(N)c(O)c([N+](=O)[O-])c1 |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . |
| Safety Phrases | S36/37 |
| WGK Germany | 3 |
| RTECS | AM6913800 |
| 2-AMINO-4-(1,1-DIMETHYL-PROPYL)-6-NITRO-PHENOL |
| 2-AMINO-4-T-PENTYL-6-NITROPHENOL |
| 2-Amino-4-tert-amyl-6-nitrophenol |
| EINECS 280-465-6 |
| MFCD00142113 |
| 2-Amino-4-tert-pentyl-6-nitrophenol |
| 2-amino-6-nitro-4-(tert-pentyl)phenol |