(4-nitrophenyl) dimethoxyphosphorylformate structure
|
Common Name | (4-nitrophenyl) dimethoxyphosphorylformate | ||
|---|---|---|---|---|
| CAS Number | 83877-26-3 | Molecular Weight | 275.15200 | |
| Density | 1.43g/cm3 | Boiling Point | 370.8ºC at 760 mmHg | |
| Molecular Formula | C9H10NO7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.1ºC | |
| Name | (4-nitrophenyl) dimethoxyphosphorylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 370.8ºC at 760 mmHg |
| Molecular Formula | C9H10NO7P |
| Molecular Weight | 275.15200 |
| Flash Point | 178.1ºC |
| Exact Mass | 275.01900 |
| PSA | 117.46000 |
| LogP | 3.10270 |
| Index of Refraction | 1.527 |
| InChIKey | LENOEKSPZDHTDQ-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
|
~72%
(4-nitrophenyl)... CAS#:83877-26-3 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-nitrophenyl dimethoxyphosphinecarboxylate oxide |
| Phosphinecarboxylic acid,dimethoxy-,4-nitrophenyl ester,oxide |